C9H16N6OS — CID 76915210
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N'-hydroxypropanimidamide (PubChem CID 76915210) has the molecular formula C9H16N6OS and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N'-hydroxypropanimidamide.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 76915210 |
| Molecular Formula | C9H16N6OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N'-hydroxypropanimidamide |
| SMILES | CC(Sc1nnnn1C1CCCC1)C(N)=NO |
| InChI | InChI=1S/C9H16N6OS/c1-6(8(10)12-16)17-9-11-13-14-15(9)7-4-2-3-5-7/h6-7,16H,2-5H2,1H3,(H2,10,12) |
| InChIKey | IFAULQJXHPJUHX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|