About (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone
(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone (PubChem CID 769176) has the molecular formula C15H13NO3
and a molecular weight of 255.27 g/mol. Its IUPAC name is (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone |
| PubChem CID | 769176 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone |
| SMILES | Nc1cc2c(cc1C(=O)c1ccccc1)OCCO2 |
| InChI | InChI=1S/C15H13NO3/c16-12-9-14-13(18-6-7-19-14)8-11(12)15(17)10-4-2-1-3-5-10/h1-5,8-9H,6-7,16H2 |
| InChIKey | ALKQZAYAWNIANE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone?
The IUPAC name of (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone (CID 769176) is (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone.
What is the SMILES notation for (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone?
The canonical SMILES for (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone is Nc1cc2c(cc1C(=O)c1ccccc1)OCCO2.
What is the InChIKey of (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone?
The InChIKey is ALKQZAYAWNIANE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3/c16-12-9-14-13(18-6-7-19-14)8-11(12)15(17)10-4-2-1-3-5-10/h1-5,8-9H,6-7,16H2.
What are the key properties of (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone?
(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone has a molecular weight of 255.27 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-phenylmethanone is sourced from PubChem (CID 769176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).