C13H14F3NO2S — CID 76917906
3-[5-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 76917906) has the molecular formula C13H14F3NO2S and a molecular weight of 305.32 g/mol. Its IUPAC name is 3-[5-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76917906 |
| Molecular Formula | C13H14F3NO2S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-[5-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(CN(CC(F)(F)F)C2CC2)s1 |
| InChI | InChI=1S/C13H14F3NO2S/c14-13(15,16)8-17(9-1-2-9)7-11-4-3-10(20-11)5-6-12(18)19/h3-6,9H,1-2,7-8H2,(H,18,19) |
| InChIKey | PHFHXYLAMHMICX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|