About 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid
3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid (PubChem CID 76918093) has the molecular formula C10H9N3O2S
and a molecular weight of 235.27 g/mol. Its IUPAC name is 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid.
Molecular Properties
| Compound Name | 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid |
| PubChem CID | 76918093 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccsc1Cn1cncn1 |
| InChI | InChI=1S/C10H9N3O2S/c14-10(15)2-1-8-3-4-16-9(8)5-13-7-11-6-12-13/h1-4,6-7H,5H2,(H,14,15) |
| InChIKey | GQUSWDZKAXCLGP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid?
The IUPAC name of 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid (CID 76918093) is 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid.
What is the SMILES notation for 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid?
The canonical SMILES for 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid is O=C(O)C=Cc1ccsc1Cn1cncn1.
What is the InChIKey of 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid?
The InChIKey is GQUSWDZKAXCLGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2S/c14-10(15)2-1-8-3-4-16-9(8)5-13-7-11-6-12-13/h1-4,6-7H,5H2,(H,14,15).
What are the key properties of 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid?
3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid has a molecular weight of 235.27 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,2,4-triazol-1-ylmethyl)thiophen-3-yl]prop-2-enoic acid is sourced from PubChem (CID 76918093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).