C19H15N3O4 — CID 7692013
4-[[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzonitrile (PubChem CID 7692013) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 4-[[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 7692013 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-[[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzonitrile |
| SMILES | C[C@]1(c2ccc3c(c2)OCO3)NC(=O)N(Cc2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C19H15N3O4/c1-19(14-6-7-15-16(8-14)26-11-25-15)17(23)22(18(24)21-19)10-13-4-2-12(9-20)3-5-13/h2-8H,10-11H2,1H3,(H,21,24)/t19-/m1/s1 |
| InChIKey | BKUVSYMNSILIGS-LJQANCHMSA-N |
| XLogP | 2.25 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|