C12H21N3O5S — CID 76920716
N-(1,1-dioxothiolan-3-yl)-4-(N'-hydroxycarbamimidoyl)-N-methyloxane-4-carboxamide (PubChem CID 76920716) has the molecular formula C12H21N3O5S and a molecular weight of 319.38 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-(N'-hydroxycarbamimidoyl)-N-methyloxane-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-(N'-hydroxycarbamimidoyl)-N-methyloxane-4-carboxamide |
|---|---|
| PubChem CID | 76920716 |
| Molecular Formula | C12H21N3O5S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-(N'-hydroxycarbamimidoyl)-N-methyloxane-4-carboxamide |
| SMILES | CN(C(=O)C1(C(N)=NO)CCOCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H21N3O5S/c1-15(9-2-7-21(18,19)8-9)11(16)12(10(13)14-17)3-5-20-6-4-12/h9,17H,2-8H2,1H3,(H2,13,14) |
| InChIKey | BVIJHGGQJFUCIJ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|