C10H21N3O4 — CID 76921530
3-amino-3-hydroxyimino-N-(2-hydroxy-3-methoxypropyl)-N,2,2-trimethylpropanamide (PubChem CID 76921530) has the molecular formula C10H21N3O4 and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-amino-3-hydroxyimino-N-(2-hydroxy-3-methoxypropyl)-N,2,2-trimethylpropanamide.
| Compound Name | 3-amino-3-hydroxyimino-N-(2-hydroxy-3-methoxypropyl)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 76921530 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 3-amino-3-hydroxyimino-N-(2-hydroxy-3-methoxypropyl)-N,2,2-trimethylpropanamide |
| SMILES | COCC(O)CN(C)C(=O)C(C)(C)C(N)=NO |
| InChI | InChI=1S/C10H21N3O4/c1-10(2,8(11)12-16)9(15)13(3)5-7(14)6-17-4/h7,14,16H,5-6H2,1-4H3,(H2,11,12) |
| InChIKey | JOYVCXBKGKUDTK-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|