C14H28N4O3 — CID 76921580
N-[2-(dimethylamino)-2-oxoethyl]-2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-propylbutanamide (PubChem CID 76921580) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-propylbutanamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-propylbutanamide |
|---|---|
| PubChem CID | 76921580 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-propylbutanamide |
| SMILES | CCCN(CC(=O)N(C)C)C(=O)C(CC)(CC)C(N)=NO |
| InChI | InChI=1S/C14H28N4O3/c1-6-9-18(10-11(19)17(4)5)13(20)14(7-2,8-3)12(15)16-21/h21H,6-10H2,1-5H3,(H2,15,16) |
| InChIKey | SIWZBZVGKWOHJI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|