About N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide
N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide (PubChem CID 76923608) has the molecular formula C10H18F3N3O2
and a molecular weight of 269.27 g/mol. Its IUPAC name is N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide.
Molecular Properties
| Compound Name | N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide |
| PubChem CID | 76923608 |
| Molecular Formula | C10H18F3N3O2 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide |
| SMILES | CCCC(C(=O)N(CC)CC(F)(F)F)C(N)=NO |
| InChI | InChI=1S/C10H18F3N3O2/c1-3-5-7(8(14)15-18)9(17)16(4-2)6-10(11,12)13/h7,18H,3-6H2,1-2H3,(H2,14,15) |
| InChIKey | SIDWAQKWIAXEPI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide?
The IUPAC name of N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide (CID 76923608) is N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide.
What is the SMILES notation for N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide?
The canonical SMILES for N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide is CCCC(C(=O)N(CC)CC(F)(F)F)C(N)=NO.
What is the InChIKey of N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide?
The InChIKey is SIDWAQKWIAXEPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3N3O2/c1-3-5-7(8(14)15-18)9(17)16(4-2)6-10(11,12)13/h7,18H,3-6H2,1-2H3,(H2,14,15).
What are the key properties of N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide?
N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide has a molecular weight of 269.27 g/mol, XLogP of 1.56, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(2,2,2-trifluoroethyl)pentanamide is sourced from PubChem (CID 76923608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).