C10H21N3O2 — CID 76924799
N-(2,2-dimethylpropyl)-2-(N'-hydroxycarbamimidoyl)butanamide (PubChem CID 76924799) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-2-(N'-hydroxycarbamimidoyl)butanamide.
| Compound Name | N-(2,2-dimethylpropyl)-2-(N'-hydroxycarbamimidoyl)butanamide |
|---|---|
| PubChem CID | 76924799 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | N-(2,2-dimethylpropyl)-2-(N'-hydroxycarbamimidoyl)butanamide |
| SMILES | CCC(C(=O)NCC(C)(C)C)C(N)=NO |
| InChI | InChI=1S/C10H21N3O2/c1-5-7(8(11)13-15)9(14)12-6-10(2,3)4/h7,15H,5-6H2,1-4H3,(H2,11,13)(H,12,14) |
| InChIKey | FWHFYRRYVRJZHJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|