About 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide
3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide (PubChem CID 76924803) has the molecular formula C8H17N3O4
and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide.
Molecular Properties
| Compound Name | 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide |
| PubChem CID | 76924803 |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide |
| SMILES | CC(C(=O)N(CCO)CCO)C(N)=NO |
| InChI | InChI=1S/C8H17N3O4/c1-6(7(9)10-15)8(14)11(2-4-12)3-5-13/h6,12-13,15H,2-5H2,1H3,(H2,9,10) |
| InChIKey | LJPHIDINYPLFFU-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide?
The IUPAC name of 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide (CID 76924803) is 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide.
What is the SMILES notation for 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide?
The canonical SMILES for 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide is CC(C(=O)N(CCO)CCO)C(N)=NO.
What is the InChIKey of 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide?
The InChIKey is LJPHIDINYPLFFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O4/c1-6(7(9)10-15)8(14)11(2-4-12)3-5-13/h6,12-13,15H,2-5H2,1H3,(H2,9,10).
What are the key properties of 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide?
3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide has a molecular weight of 219.24 g/mol, XLogP of -1.82, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyimino-2-methylpropanamide is sourced from PubChem (CID 76924803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).