About 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide
2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide (PubChem CID 76924806) has the molecular formula C10H21N3O4
and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide.
Molecular Properties
| Compound Name | 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide |
| PubChem CID | 76924806 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)N(CCO)CCO)C(N)=NO |
| InChI | InChI=1S/C10H21N3O4/c1-7(2)8(9(11)12-17)10(16)13(3-5-14)4-6-15/h7-8,14-15,17H,3-6H2,1-2H3,(H2,11,12) |
| InChIKey | ROCARJTTYKYOJB-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide?
The IUPAC name of 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide (CID 76924806) is 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide.
What is the SMILES notation for 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide?
The canonical SMILES for 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide is CC(C)C(C(=O)N(CCO)CCO)C(N)=NO.
What is the InChIKey of 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide?
The InChIKey is ROCARJTTYKYOJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O4/c1-7(2)8(9(11)12-17)10(16)13(3-5-14)4-6-15/h7-8,14-15,17H,3-6H2,1-2H3,(H2,11,12).
What are the key properties of 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide?
2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide has a molecular weight of 247.29 g/mol, XLogP of -1.18, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N'-hydroxycarbamimidoyl)-N,N-bis(2-hydroxyethyl)-3-methylbutanamide is sourced from PubChem (CID 76924806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).