About N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide
N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide (PubChem CID 7692601) has the molecular formula C12H13N3O3
and a molecular weight of 247.25 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide.
Molecular Properties
| Compound Name | N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide |
| PubChem CID | 7692601 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide |
| SMILES | CCC(=O)Nc1nonc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C12H13N3O3/c1-3-10(16)13-12-11(14-18-15-12)8-4-6-9(17-2)7-5-8/h4-7H,3H2,1-2H3,(H,13,15,16) |
| InChIKey | YHWSJNUQINFECJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide?
The IUPAC name of N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide (CID 7692601) is N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide.
What is the SMILES notation for N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide?
The canonical SMILES for N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide is CCC(=O)Nc1nonc1-c1ccc(OC)cc1.
What is the InChIKey of N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide?
The InChIKey is YHWSJNUQINFECJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O3/c1-3-10(16)13-12-11(14-18-15-12)8-4-6-9(17-2)7-5-8/h4-7H,3H2,1-2H3,(H,13,15,16).
What are the key properties of N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide?
N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide has a molecular weight of 247.25 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]propanamide is sourced from PubChem (CID 7692601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).