C16H21NO3 — CID 76927609
3-[3-[2,2-dimethylpropyl(methyl)carbamoyl]phenyl]prop-2-enoic acid (PubChem CID 76927609) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-[3-[2,2-dimethylpropyl(methyl)carbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[2,2-dimethylpropyl(methyl)carbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76927609 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-[3-[2,2-dimethylpropyl(methyl)carbamoyl]phenyl]prop-2-enoic acid |
| SMILES | CN(CC(C)(C)C)C(=O)c1cccc(C=CC(=O)O)c1 |
| InChI | InChI=1S/C16H21NO3/c1-16(2,3)11-17(4)15(20)13-7-5-6-12(10-13)8-9-14(18)19/h5-10H,11H2,1-4H3,(H,18,19) |
| InChIKey | VOTDIZXOQUAKFY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|