About 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide
2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide (PubChem CID 76927760) has the molecular formula C12H17ClFN3O
and a molecular weight of 273.74 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide |
| PubChem CID | 76927760 |
| Molecular Formula | C12H17ClFN3O |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide |
| SMILES | CCCN(CC(N)=NO)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C12H17ClFN3O/c1-2-6-17(8-12(15)16-18)7-9-10(13)4-3-5-11(9)14/h3-5,18H,2,6-8H2,1H3,(H2,15,16) |
| InChIKey | JXCCMFXRKADVRR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide (CID 76927760) is 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide is CCCN(CC(N)=NO)Cc1c(F)cccc1Cl.
What is the InChIKey of 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide?
The InChIKey is JXCCMFXRKADVRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClFN3O/c1-2-6-17(8-12(15)16-18)7-9-10(13)4-3-5-11(9)14/h3-5,18H,2,6-8H2,1H3,(H2,15,16).
What are the key properties of 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide?
2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide has a molecular weight of 273.74 g/mol, XLogP of 2.44, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-6-fluorophenyl)methyl-propylamino]-N'-hydroxyethanimidamide is sourced from PubChem (CID 76927760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).