C6H16N4O3S — CID 76928290
2-[dimethylsulfamoyl(methyl)amino]-N'-hydroxypropanimidamide (PubChem CID 76928290) has the molecular formula C6H16N4O3S and a molecular weight of 224.29 g/mol. Its IUPAC name is 2-[dimethylsulfamoyl(methyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 2-[dimethylsulfamoyl(methyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 76928290 |
| Molecular Formula | C6H16N4O3S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-[dimethylsulfamoyl(methyl)amino]-N'-hydroxypropanimidamide |
| SMILES | CC(C(N)=NO)N(C)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C6H16N4O3S/c1-5(6(7)8-11)10(4)14(12,13)9(2)3/h5,11H,1-4H3,(H2,7,8) |
| InChIKey | QPIDNMIYCDGWFD-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|