C20H18ClN3O3 — CID 7692848
N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methyl-3-prop-2-enoxybenzamide (PubChem CID 7692848) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methyl-3-prop-2-enoxybenzamide.
| Compound Name | N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methyl-3-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 7692848 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methyl-3-prop-2-enoxybenzamide |
| SMILES | C=CCOc1cccc(C(=O)N(C)Cc2nc(-c3ccc(Cl)cc3)no2)c1 |
| InChI | InChI=1S/C20H18ClN3O3/c1-3-11-26-17-6-4-5-15(12-17)20(25)24(2)13-18-22-19(23-27-18)14-7-9-16(21)10-8-14/h3-10,12H,1,11,13H2,2H3 |
| InChIKey | OGIBXGPGSLVBFY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|