About 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide
2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide (PubChem CID 76928932) has the molecular formula C8H18N4O3S
and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide |
| PubChem CID | 76928932 |
| Molecular Formula | C8H18N4O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide |
| SMILES | CCN(CC(N)=NO)S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C8H18N4O3S/c1-2-11(7-8(9)10-13)16(14,15)12-5-3-4-6-12/h13H,2-7H2,1H3,(H2,9,10) |
| InChIKey | DCWBUPAGZBAYQG-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide (CID 76928932) is 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide is CCN(CC(N)=NO)S(=O)(=O)N1CCCC1.
What is the InChIKey of 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide?
The InChIKey is DCWBUPAGZBAYQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4O3S/c1-2-11(7-8(9)10-13)16(14,15)12-5-3-4-6-12/h13H,2-7H2,1H3,(H2,9,10).
What are the key properties of 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide?
2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide has a molecular weight of 250.32 g/mol, XLogP of -0.60, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(pyrrolidin-1-ylsulfonyl)amino]-N'-hydroxyethanimidamide is sourced from PubChem (CID 76928932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).