About (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione
(3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione (PubChem CID 7692921) has the molecular formula C25H24N2O2
and a molecular weight of 384.48 g/mol. Its IUPAC name is (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione |
| PubChem CID | 7692921 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)CN(c3c(C)cccc3C)C(=O)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O2/c1-17-12-14-21(15-13-17)27-22(28)16-26(23-18(2)8-7-9-19(23)3)25(29)24(27)20-10-5-4-6-11-20/h4-15,24H,16H2,1-3H3/t24-/m1/s1 |
| InChIKey | VBYGJSLDLSZXQR-XMMPIXPASA-N |
| XLogP | 4.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione?
The IUPAC name of (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione (CID 7692921) is (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione.
What is the SMILES notation for (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione?
The canonical SMILES for (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione is Cc1ccc(N2C(=O)CN(c3c(C)cccc3C)C(=O)[C@H]2c2ccccc2)cc1.
What is the InChIKey of (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione?
The InChIKey is VBYGJSLDLSZXQR-XMMPIXPASA-N. The full InChI is InChI=1S/C25H24N2O2/c1-17-12-14-21(15-13-17)27-22(28)16-26(23-18(2)8-7-9-19(23)3)25(29)24(27)20-10-5-4-6-11-20/h4-15,24H,16H2,1-3H3/t24-/m1/s1.
What are the key properties of (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione?
(3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione has a molecular weight of 384.48 g/mol, XLogP of 4.73, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(2,6-dimethylphenyl)-4-(4-methylphenyl)-3-phenylpiperazine-2,5-dione is sourced from PubChem (CID 7692921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).