About 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide
2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide (PubChem CID 76929267) has the molecular formula C9H11Cl2N3O3S
and a molecular weight of 312.18 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide |
| PubChem CID | 76929267 |
| Molecular Formula | C9H11Cl2N3O3S |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide |
| SMILES | CN(CC(N)=NO)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H11Cl2N3O3S/c1-14(5-9(12)13-15)18(16,17)8-3-6(10)2-7(11)4-8/h2-4,15H,5H2,1H3,(H2,12,13) |
| InChIKey | JWOGRONQCGNNSL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide (CID 76929267) is 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide is CN(CC(N)=NO)S(=O)(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide?
The InChIKey is JWOGRONQCGNNSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl2N3O3S/c1-14(5-9(12)13-15)18(16,17)8-3-6(10)2-7(11)4-8/h2-4,15H,5H2,1H3,(H2,12,13).
What are the key properties of 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide?
2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide has a molecular weight of 312.18 g/mol, XLogP of 1.36, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide is sourced from PubChem (CID 76929267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).