C12H17N3O3 — CID 76930231
ethyl 3-[3-(2-methylpyrazol-3-yl)prop-2-enoylamino]propanoate (PubChem CID 76930231) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is ethyl 3-[3-(2-methylpyrazol-3-yl)prop-2-enoylamino]propanoate.
| Compound Name | ethyl 3-[3-(2-methylpyrazol-3-yl)prop-2-enoylamino]propanoate |
|---|---|
| PubChem CID | 76930231 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | ethyl 3-[3-(2-methylpyrazol-3-yl)prop-2-enoylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)C=Cc1ccnn1C |
| InChI | InChI=1S/C12H17N3O3/c1-3-18-12(17)7-8-13-11(16)5-4-10-6-9-14-15(10)2/h4-6,9H,3,7-8H2,1-2H3,(H,13,16) |
| InChIKey | VCWWDBSYQDSGHZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|