C19H22N6O3 — CID 7693050
N'-[2-(2,3-dimethylphenoxy)acetyl]-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetohydrazide (PubChem CID 7693050) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is N'-[2-(2,3-dimethylphenoxy)acetyl]-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetohydrazide.
| Compound Name | N'-[2-(2,3-dimethylphenoxy)acetyl]-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 7693050 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N'-[2-(2,3-dimethylphenoxy)acetyl]-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetohydrazide |
| SMILES | Cc1cc(C)n2nc(CC(=O)NNC(=O)COc3cccc(C)c3C)nc2n1 |
| InChI | InChI=1S/C19H22N6O3/c1-11-6-5-7-15(14(11)4)28-10-18(27)23-22-17(26)9-16-21-19-20-12(2)8-13(3)25(19)24-16/h5-8H,9-10H2,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | BLCRWNMXIHZDKR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|