C18H19NO2 — CID 76931011
3-[3-[(N,2-dimethylanilino)methyl]phenyl]prop-2-enoic acid (PubChem CID 76931011) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[3-[(N,2-dimethylanilino)methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[(N,2-dimethylanilino)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76931011 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-[3-[(N,2-dimethylanilino)methyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1ccccc1N(C)Cc1cccc(C=CC(=O)O)c1 |
| InChI | InChI=1S/C18H19NO2/c1-14-6-3-4-9-17(14)19(2)13-16-8-5-7-15(12-16)10-11-18(20)21/h3-12H,13H2,1-2H3,(H,20,21) |
| InChIKey | DUVRWOQKJITKME-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|