C13H12BrN3O2S — CID 76932721
3-bromo-N-[3-(N'-hydroxycarbamimidoyl)phenyl]-N-methylthiophene-2-carboxamide (PubChem CID 76932721) has the molecular formula C13H12BrN3O2S and a molecular weight of 354.23 g/mol. Its IUPAC name is 3-bromo-N-[3-(N'-hydroxycarbamimidoyl)phenyl]-N-methylthiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[3-(N'-hydroxycarbamimidoyl)phenyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 76932721 |
| Molecular Formula | C13H12BrN3O2S |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 3-bromo-N-[3-(N'-hydroxycarbamimidoyl)phenyl]-N-methylthiophene-2-carboxamide |
| SMILES | CN(C(=O)c1sccc1Br)c1cccc(C(N)=NO)c1 |
| InChI | InChI=1S/C13H12BrN3O2S/c1-17(13(18)11-10(14)5-6-20-11)9-4-2-3-8(7-9)12(15)16-19/h2-7,19H,1H3,(H2,15,16) |
| InChIKey | UEUXVTWQAPKEIT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|