About 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide
2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide (PubChem CID 76933276) has the molecular formula C12H23N5O3S
and a molecular weight of 317.42 g/mol. Its IUPAC name is 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide |
| PubChem CID | 76933276 |
| Molecular Formula | C12H23N5O3S |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide |
| SMILES | CCn1cc(S(=O)(=O)NC(CC)(CC)C(N)=NO)nc1C |
| InChI | InChI=1S/C12H23N5O3S/c1-5-12(6-2,11(13)15-18)16-21(19,20)10-8-17(7-3)9(4)14-10/h8,16,18H,5-7H2,1-4H3,(H2,13,15) |
| InChIKey | ZNQVDUYGHRGABW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide?
The IUPAC name of 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide (CID 76933276) is 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide.
What is the SMILES notation for 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide?
The canonical SMILES for 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide is CCn1cc(S(=O)(=O)NC(CC)(CC)C(N)=NO)nc1C.
What is the InChIKey of 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide?
The InChIKey is ZNQVDUYGHRGABW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N5O3S/c1-5-12(6-2,11(13)15-18)16-21(19,20)10-8-17(7-3)9(4)14-10/h8,16,18H,5-7H2,1-4H3,(H2,13,15).
What are the key properties of 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide?
2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide has a molecular weight of 317.42 g/mol, XLogP of 0.79, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide is sourced from PubChem (CID 76933276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).