C11H13F3N4O3 — CID 76934984
4-[ethyl(2,2,2-trifluoroethyl)amino]-N'-hydroxy-3-nitrobenzenecarboximidamide (PubChem CID 76934984) has the molecular formula C11H13F3N4O3 and a molecular weight of 306.24 g/mol. Its IUPAC name is 4-[ethyl(2,2,2-trifluoroethyl)amino]-N'-hydroxy-3-nitrobenzenecarboximidamide.
| Compound Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]-N'-hydroxy-3-nitrobenzenecarboximidamide |
|---|---|
| PubChem CID | 76934984 |
| Molecular Formula | C11H13F3N4O3 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]-N'-hydroxy-3-nitrobenzenecarboximidamide |
| SMILES | CCN(CC(F)(F)F)c1ccc(C(N)=NO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13F3N4O3/c1-2-17(6-11(12,13)14)8-4-3-7(10(15)16-19)5-9(8)18(20)21/h3-5,19H,2,6H2,1H3,(H2,15,16) |
| InChIKey | FTUZGDCWSIXHLI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|