C12H15N3O5 — CID 76935447
N'-hydroxy-5-nitro-2-(oxolan-3-ylmethoxy)benzenecarboximidamide (PubChem CID 76935447) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is N'-hydroxy-5-nitro-2-(oxolan-3-ylmethoxy)benzenecarboximidamide.
| Compound Name | N'-hydroxy-5-nitro-2-(oxolan-3-ylmethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 76935447 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N'-hydroxy-5-nitro-2-(oxolan-3-ylmethoxy)benzenecarboximidamide |
| SMILES | NC(=NO)c1cc([N+](=O)[O-])ccc1OCC1CCOC1 |
| InChI | InChI=1S/C12H15N3O5/c13-12(14-16)10-5-9(15(17)18)1-2-11(10)20-7-8-3-4-19-6-8/h1-2,5,8,16H,3-4,6-7H2,(H2,13,14) |
| InChIKey | ZYZUBOTZGVUZIN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|