C15H20N2O2 — CID 76936194
3-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enoic acid (PubChem CID 76936194) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76936194 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C=CC(=O)O)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C15H20N2O2/c1-12-11-13(4-6-15(18)19)3-5-14(12)17-9-7-16(2)8-10-17/h3-6,11H,7-10H2,1-2H3,(H,18,19) |
| InChIKey | MVDGMUIOSWDEGX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|