C9H13N5O2 — CID 76937052
N-(3-amino-3-hydroxyiminopropyl)-N-methylpyrazine-2-carboxamide (PubChem CID 76937052) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-N-methylpyrazine-2-carboxamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-N-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 76937052 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-N-methylpyrazine-2-carboxamide |
| SMILES | CN(CCC(N)=NO)C(=O)c1cnccn1 |
| InChI | InChI=1S/C9H13N5O2/c1-14(5-2-8(10)13-16)9(15)7-6-11-3-4-12-7/h3-4,6,16H,2,5H2,1H3,(H2,10,13) |
| InChIKey | PCJCUMODSRNPLR-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|