C22H16ClFN2O2 — CID 7693734
(3S)-4-(4-chlorophenyl)-1-(2-fluorophenyl)-3-phenylpiperazine-2,5-dione (PubChem CID 7693734) has the molecular formula C22H16ClFN2O2 and a molecular weight of 394.83 g/mol. Its IUPAC name is (3S)-4-(4-chlorophenyl)-1-(2-fluorophenyl)-3-phenylpiperazine-2,5-dione.
| Compound Name | (3S)-4-(4-chlorophenyl)-1-(2-fluorophenyl)-3-phenylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 7693734 |
| Molecular Formula | C22H16ClFN2O2 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | (3S)-4-(4-chlorophenyl)-1-(2-fluorophenyl)-3-phenylpiperazine-2,5-dione |
| SMILES | O=C1[C@H](c2ccccc2)N(c2ccc(Cl)cc2)C(=O)CN1c1ccccc1F |
| InChI | InChI=1S/C22H16ClFN2O2/c23-16-10-12-17(13-11-16)26-20(27)14-25(19-9-5-4-8-18(19)24)22(28)21(26)15-6-2-1-3-7-15/h1-13,21H,14H2/t21-/m0/s1 |
| InChIKey | WSHGCWSCNOMYBT-NRFANRHFSA-N |
| XLogP | 4.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |