About 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid
2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid (PubChem CID 7693810) has the molecular formula C20H17FN2O5
and a molecular weight of 384.36 g/mol. Its IUPAC name is 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid |
| PubChem CID | 7693810 |
| Molecular Formula | C20H17FN2O5 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid |
| SMILES | CC(=O)c1ccc(NC(=O)[C@@]2(CC(=O)O)CC(c3ccc(F)cc3)=NO2)cc1 |
| InChI | InChI=1S/C20H17FN2O5/c1-12(24)13-4-8-16(9-5-13)22-19(27)20(11-18(25)26)10-17(23-28-20)14-2-6-15(21)7-3-14/h2-9H,10-11H2,1H3,(H,22,27)(H,25,26)/t20-/m0/s1 |
| InChIKey | LZYYFCJMQVOODB-FQEVSTJZSA-N |
| XLogP | 3.00 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid?
The IUPAC name of 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid (CID 7693810) is 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid.
What is the SMILES notation for 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid?
The canonical SMILES for 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid is CC(=O)c1ccc(NC(=O)[C@@]2(CC(=O)O)CC(c3ccc(F)cc3)=NO2)cc1.
What is the InChIKey of 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid?
The InChIKey is LZYYFCJMQVOODB-FQEVSTJZSA-N. The full InChI is InChI=1S/C20H17FN2O5/c1-12(24)13-4-8-16(9-5-13)22-19(27)20(11-18(25)26)10-17(23-28-20)14-2-6-15(21)7-3-14/h2-9H,10-11H2,1H3,(H,22,27)(H,25,26)/t20-/m0/s1.
What are the key properties of 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid?
2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid has a molecular weight of 384.36 g/mol, XLogP of 3.00, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5S)-5-[(4-acetylphenyl)carbamoyl]-3-(4-fluorophenyl)-4H-1,2-oxazol-5-yl]acetic acid is sourced from PubChem (CID 7693810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).