C17H21N3O — CID 76939093
2-[benzyl(ethyl)amino]-N'-hydroxy-4-methylbenzenecarboximidamide (PubChem CID 76939093) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-[benzyl(ethyl)amino]-N'-hydroxy-4-methylbenzenecarboximidamide.
| Compound Name | 2-[benzyl(ethyl)amino]-N'-hydroxy-4-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 76939093 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-[benzyl(ethyl)amino]-N'-hydroxy-4-methylbenzenecarboximidamide |
| SMILES | CCN(Cc1ccccc1)c1cc(C)ccc1C(N)=NO |
| InChI | InChI=1S/C17H21N3O/c1-3-20(12-14-7-5-4-6-8-14)16-11-13(2)9-10-15(16)17(18)19-21/h4-11,21H,3,12H2,1-2H3,(H2,18,19) |
| InChIKey | NDVMMSZZANASFN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|