About 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide
5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide (PubChem CID 76939330) has the molecular formula C12H9BrFN3O2S
and a molecular weight of 358.19 g/mol. Its IUPAC name is 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide |
| PubChem CID | 76939330 |
| Molecular Formula | C12H9BrFN3O2S |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide |
| SMILES | NC(=NO)c1cc(NC(=O)c2ccc(Br)s2)ccc1F |
| InChI | InChI=1S/C12H9BrFN3O2S/c13-10-4-3-9(20-10)12(18)16-6-1-2-8(14)7(5-6)11(15)17-19/h1-5,19H,(H2,15,17)(H,16,18) |
| InChIKey | BOXYYZIRGWSUTB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide?
The IUPAC name of 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide (CID 76939330) is 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide.
What is the SMILES notation for 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide?
The canonical SMILES for 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide is NC(=NO)c1cc(NC(=O)c2ccc(Br)s2)ccc1F.
What is the InChIKey of 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide?
The InChIKey is BOXYYZIRGWSUTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrFN3O2S/c13-10-4-3-9(20-10)12(18)16-6-1-2-8(14)7(5-6)11(15)17-19/h1-5,19H,(H2,15,17)(H,16,18).
What are the key properties of 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide?
5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide has a molecular weight of 358.19 g/mol, XLogP of 3.00, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[4-fluoro-3-(N'-hydroxycarbamimidoyl)phenyl]thiophene-2-carboxamide is sourced from PubChem (CID 76939330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).