4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid

C8H8N2O5 — CID 76941170

IUPAC4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid
SMILESCN1C(=O)C(=O)N(CC=CC(=O)O)C1=O
InChIInChI=1S/C8H8N2O5/c1-9-6(13)7(14)10(8(9)15)4-2-3-5(11)12/h2-3H,4H2,1H3,(H,11,12)
InChIKeyNISJROROLBBAKA-UHFFFAOYSA-N
MW212.16 g/mol
LogP-0.95
Rot. Bonds3

About 4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid

4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid (PubChem CID 76941170) has the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. Its IUPAC name is 4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid.

Molecular Properties

Compound Name4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid
PubChem CID76941170
Molecular FormulaC8H8N2O5
Molecular Weight212.16 g/mol
Exact Mass212.04
IUPAC Name4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid
SMILESCN1C(=O)C(=O)N(CC=CC(=O)O)C1=O
InChIInChI=1S/C8H8N2O5/c1-9-6(13)7(14)10(8(9)15)4-2-3-5(11)12/h2-3H,4H2,1H3,(H,11,12)
InChIKeyNISJROROLBBAKA-UHFFFAOYSA-N
XLogP-0.95
TPSA94.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.16
LogP ≤ 5-0.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid?
The IUPAC name of 4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid (CID 76941170) is 4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid.
What is the SMILES notation for 4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid?
The canonical SMILES for 4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid is CN1C(=O)C(=O)N(CC=CC(=O)O)C1=O.
What is the InChIKey of 4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid?
The InChIKey is NISJROROLBBAKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O5/c1-9-6(13)7(14)10(8(9)15)4-2-3-5(11)12/h2-3H,4H2,1H3,(H,11,12).
What are the key properties of 4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid?
4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid has a molecular weight of 212.16 g/mol, XLogP of -0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid is sourced from PubChem (CID 76941170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).