About 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide
3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide (PubChem CID 76941353) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide.
Molecular Properties
| Compound Name | 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide |
| PubChem CID | 76941353 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide |
| SMILES | Cc1ncn(CC(C)C(N)=NO)c1C |
| InChI | InChI=1S/C9H16N4O/c1-6(9(10)12-14)4-13-5-11-7(2)8(13)3/h5-6,14H,4H2,1-3H3,(H2,10,12) |
| InChIKey | DNQHBUKROUGHNA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide?
The IUPAC name of 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide (CID 76941353) is 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide.
What is the SMILES notation for 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide?
The canonical SMILES for 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide is Cc1ncn(CC(C)C(N)=NO)c1C.
What is the InChIKey of 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide?
The InChIKey is DNQHBUKROUGHNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c1-6(9(10)12-14)4-13-5-11-7(2)8(13)3/h5-6,14H,4H2,1-3H3,(H2,10,12).
What are the key properties of 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide?
3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide has a molecular weight of 196.25 g/mol, XLogP of 0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethylimidazol-1-yl)-N'-hydroxy-2-methylpropanimidamide is sourced from PubChem (CID 76941353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).