C18H23N5O2 — CID 7694290
2-(4,6-dimethylpyrimidin-2-yl)-6-methyl-5-pentyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione (PubChem CID 7694290) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)-6-methyl-5-pentyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)-6-methyl-5-pentyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
|---|---|
| PubChem CID | 7694290 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)-6-methyl-5-pentyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
| SMILES | CCCCCc1c(C)[nH]c2[nH]n(-c3nc(C)cc(C)n3)c(=O)c2c1=O |
| InChI | InChI=1S/C18H23N5O2/c1-5-6-7-8-13-12(4)21-16-14(15(13)24)17(25)23(22-16)18-19-10(2)9-11(3)20-18/h9H,5-8H2,1-4H3,(H2,21,22,24) |
| InChIKey | CVVTZRATBXAABF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|