C12H25NO2 — CID 76943229
3-(1-cyclohexylpropylamino)propane-1,2-diol (PubChem CID 76943229) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-(1-cyclohexylpropylamino)propane-1,2-diol.
| Compound Name | 3-(1-cyclohexylpropylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 76943229 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 3-(1-cyclohexylpropylamino)propane-1,2-diol |
| SMILES | CCC(NCC(O)CO)C1CCCCC1 |
| InChI | InChI=1S/C12H25NO2/c1-2-12(13-8-11(15)9-14)10-6-4-3-5-7-10/h10-15H,2-9H2,1H3 |
| InChIKey | DBTQNOUXXLWCRK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |