About 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide
3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide (PubChem CID 76943340) has the molecular formula C8H14N4OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide |
| PubChem CID | 76943340 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide |
| SMILES | Cc1cc(SCCC(N)=NO)n(C)n1 |
| InChI | InChI=1S/C8H14N4OS/c1-6-5-8(12(2)10-6)14-4-3-7(9)11-13/h5,13H,3-4H2,1-2H3,(H2,9,11) |
| InChIKey | CPVIOIYYAALXQF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide?
The IUPAC name of 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide (CID 76943340) is 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide.
What is the SMILES notation for 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide?
The canonical SMILES for 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide is Cc1cc(SCCC(N)=NO)n(C)n1.
What is the InChIKey of 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide?
The InChIKey is CPVIOIYYAALXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4OS/c1-6-5-8(12(2)10-6)14-4-3-7(9)11-13/h5,13H,3-4H2,1-2H3,(H2,9,11).
What are the key properties of 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide?
3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide has a molecular weight of 214.29 g/mol, XLogP of 0.96, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-N'-hydroxypropanimidamide is sourced from PubChem (CID 76943340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).