C19H20ClNO3 — CID 7694345
[2-(2-chloro-4-methylanilino)-2-oxoethyl] 4-propan-2-ylbenzoate (PubChem CID 7694345) has the molecular formula C19H20ClNO3 and a molecular weight of 345.83 g/mol. Its IUPAC name is [2-(2-chloro-4-methylanilino)-2-oxoethyl] 4-propan-2-ylbenzoate.
| Compound Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl] 4-propan-2-ylbenzoate |
|---|---|
| PubChem CID | 7694345 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl] 4-propan-2-ylbenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(C(C)C)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClNO3/c1-12(2)14-5-7-15(8-6-14)19(23)24-11-18(22)21-17-9-4-13(3)10-16(17)20/h4-10,12H,11H2,1-3H3,(H,21,22) |
| InChIKey | UBBJEKLNHYANNP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |