C17H27NO — CID 76943582
N-(2-methylpropyl)-4-(2-prop-1-enylphenoxy)butan-1-amine (PubChem CID 76943582) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is N-(2-methylpropyl)-4-(2-prop-1-enylphenoxy)butan-1-amine.
| Compound Name | N-(2-methylpropyl)-4-(2-prop-1-enylphenoxy)butan-1-amine |
|---|---|
| PubChem CID | 76943582 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | N-(2-methylpropyl)-4-(2-prop-1-enylphenoxy)butan-1-amine |
| SMILES | CC=Cc1ccccc1OCCCCNCC(C)C |
| InChI | InChI=1S/C17H27NO/c1-4-9-16-10-5-6-11-17(16)19-13-8-7-12-18-14-15(2)3/h4-6,9-11,15,18H,7-8,12-14H2,1-3H3 |
| InChIKey | OGFPEUGBPQJYGL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|