About 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide (PubChem CID 76944784) has the molecular formula C12H12BrClN4O
and a molecular weight of 343.61 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide.
Molecular Properties
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide |
| PubChem CID | 76944784 |
| Molecular Formula | C12H12BrClN4O |
| Molecular Weight | 343.61 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide |
| SMILES | Cc1nn(-c2ccc(Cl)cc2C(N)=NO)c(C)c1Br |
| InChI | InChI=1S/C12H12BrClN4O/c1-6-11(13)7(2)18(16-6)10-4-3-8(14)5-9(10)12(15)17-19/h3-5,19H,1-2H3,(H2,15,17) |
| InChIKey | MCMPOUIWUUWKBY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide?
The IUPAC name of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide (CID 76944784) is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide.
What is the SMILES notation for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide?
The canonical SMILES for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide is Cc1nn(-c2ccc(Cl)cc2C(N)=NO)c(C)c1Br.
What is the InChIKey of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide?
The InChIKey is MCMPOUIWUUWKBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrClN4O/c1-6-11(13)7(2)18(16-6)10-4-3-8(14)5-9(10)12(15)17-19/h3-5,19H,1-2H3,(H2,15,17).
What are the key properties of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide?
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide has a molecular weight of 343.61 g/mol, XLogP of 3.00, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-5-chloro-N'-hydroxybenzenecarboximidamide is sourced from PubChem (CID 76944784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).