C22H24FNO3 — CID 7694591
(E)-N-[(1R)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 7694591) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7694591 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (E)-N-[(1R)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | CC(C)[C@@H](NC(=O)/C=C/c1ccc(F)cc1)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C22H24FNO3/c1-15(2)22(17-7-10-19-20(14-17)27-13-3-12-26-19)24-21(25)11-6-16-4-8-18(23)9-5-16/h4-11,14-15,22H,3,12-13H2,1-2H3,(H,24,25)/b11-6+/t22-/m1/s1 |
| InChIKey | KGDVKWKIGPRDTQ-NOUTYMABSA-N |
| XLogP | 4.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|