About N'-amino-2-(3,5-dimethylphenyl)ethanimidamide
N'-amino-2-(3,5-dimethylphenyl)ethanimidamide (PubChem CID 76947129) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is N'-amino-2-(3,5-dimethylphenyl)ethanimidamide.
Molecular Properties
| Compound Name | N'-amino-2-(3,5-dimethylphenyl)ethanimidamide |
| PubChem CID | 76947129 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N'-amino-2-(3,5-dimethylphenyl)ethanimidamide |
| SMILES | Cc1cc(C)cc(CC(N)=NN)c1 |
| InChI | InChI=1S/C10H15N3/c1-7-3-8(2)5-9(4-7)6-10(11)13-12/h3-5H,6,12H2,1-2H3,(H2,11,13) |
| InChIKey | UQORHLDQOQEDOW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-2-(3,5-dimethylphenyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-2-(3,5-dimethylphenyl)ethanimidamide?
The IUPAC name of N'-amino-2-(3,5-dimethylphenyl)ethanimidamide (CID 76947129) is N'-amino-2-(3,5-dimethylphenyl)ethanimidamide.
What is the SMILES notation for N'-amino-2-(3,5-dimethylphenyl)ethanimidamide?
The canonical SMILES for N'-amino-2-(3,5-dimethylphenyl)ethanimidamide is Cc1cc(C)cc(CC(N)=NN)c1.
What is the InChIKey of N'-amino-2-(3,5-dimethylphenyl)ethanimidamide?
The InChIKey is UQORHLDQOQEDOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-7-3-8(2)5-9(4-7)6-10(11)13-12/h3-5H,6,12H2,1-2H3,(H2,11,13).
What are the key properties of N'-amino-2-(3,5-dimethylphenyl)ethanimidamide?
N'-amino-2-(3,5-dimethylphenyl)ethanimidamide has a molecular weight of 177.25 g/mol, XLogP of 1.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-2-(3,5-dimethylphenyl)ethanimidamide is sourced from PubChem (CID 76947129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).