C17H15N3O3 — CID 7694878
3-[(2,5-dimethylphenyl)methyl]-6-nitroquinazolin-4-one (PubChem CID 7694878) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenyl)methyl]-6-nitroquinazolin-4-one.
| Compound Name | 3-[(2,5-dimethylphenyl)methyl]-6-nitroquinazolin-4-one |
|---|---|
| PubChem CID | 7694878 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3-[(2,5-dimethylphenyl)methyl]-6-nitroquinazolin-4-one |
| SMILES | Cc1ccc(C)c(Cn2cnc3ccc([N+](=O)[O-])cc3c2=O)c1 |
| InChI | InChI=1S/C17H15N3O3/c1-11-3-4-12(2)13(7-11)9-19-10-18-16-6-5-14(20(22)23)8-15(16)17(19)21/h3-8,10H,9H2,1-2H3 |
| InChIKey | LKHCXSJDNVXFKC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|