C14H19NO2 — CID 76948829
2,4-dimethyl-1-(4-methyl-2-nitropent-1-enyl)benzene (PubChem CID 76948829) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2,4-dimethyl-1-(4-methyl-2-nitropent-1-enyl)benzene.
| Compound Name | 2,4-dimethyl-1-(4-methyl-2-nitropent-1-enyl)benzene |
|---|---|
| PubChem CID | 76948829 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2,4-dimethyl-1-(4-methyl-2-nitropent-1-enyl)benzene |
| SMILES | Cc1ccc(C=C(CC(C)C)[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C14H19NO2/c1-10(2)7-14(15(16)17)9-13-6-5-11(3)8-12(13)4/h5-6,8-10H,7H2,1-4H3 |
| InChIKey | SBZJRLSNCRKEMK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|