[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate

C18H17BrO6 — CID 7694899

IUPAC[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate
SMILESCOc1ccc(C(=O)COC(=O)COc2cccc(Br)c2)c(OC)c1
InChIInChI=1S/C18H17BrO6/c1-22-13-6-7-15(17(9-13)23-2)16(20)10-25-18(21)11-24-14-5-3-4-12(19)8-14/h3-9H,10-11H2,1-2H3
InChIKeyQNQSQPLHDJEGAH-UHFFFAOYSA-N
MW409.23 g/mol
LogP3.27
Rot. Bonds8

About [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate

[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate (PubChem CID 7694899) has the molecular formula C18H17BrO6 and a molecular weight of 409.23 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate.

Molecular Properties

Compound Name[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate
PubChem CID7694899
Molecular FormulaC18H17BrO6
Molecular Weight409.23 g/mol
Exact Mass408.02
IUPAC Name[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate
SMILESCOc1ccc(C(=O)COC(=O)COc2cccc(Br)c2)c(OC)c1
InChIInChI=1S/C18H17BrO6/c1-22-13-6-7-15(17(9-13)23-2)16(20)10-25-18(21)11-24-14-5-3-4-12(19)8-14/h3-9H,10-11H2,1-2H3
InChIKeyQNQSQPLHDJEGAH-UHFFFAOYSA-N
XLogP3.27
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500409.23
LogP ≤ 53.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate?
The IUPAC name of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate (CID 7694899) is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate.
What is the SMILES notation for [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate?
The canonical SMILES for [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate is COc1ccc(C(=O)COC(=O)COc2cccc(Br)c2)c(OC)c1.
What is the InChIKey of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate?
The InChIKey is QNQSQPLHDJEGAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrO6/c1-22-13-6-7-15(17(9-13)23-2)16(20)10-25-18(21)11-24-14-5-3-4-12(19)8-14/h3-9H,10-11H2,1-2H3.
What are the key properties of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate?
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate has a molecular weight of 409.23 g/mol, XLogP of 3.27, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate is sourced from PubChem (CID 7694899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).