C18H17BrO6 — CID 7694899
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate (PubChem CID 7694899) has the molecular formula C18H17BrO6 and a molecular weight of 409.23 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate |
|---|---|
| PubChem CID | 7694899 |
| Molecular Formula | C18H17BrO6 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate |
| SMILES | COc1ccc(C(=O)COC(=O)COc2cccc(Br)c2)c(OC)c1 |
| InChI | InChI=1S/C18H17BrO6/c1-22-13-6-7-15(17(9-13)23-2)16(20)10-25-18(21)11-24-14-5-3-4-12(19)8-14/h3-9H,10-11H2,1-2H3 |
| InChIKey | QNQSQPLHDJEGAH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |