C10H12N4S — CID 7694999
1-prop-2-enyl-3-[(E)-pyridin-4-ylmethylideneamino]thiourea (PubChem CID 7694999) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 1-prop-2-enyl-3-[(E)-pyridin-4-ylmethylideneamino]thiourea.
| Compound Name | 1-prop-2-enyl-3-[(E)-pyridin-4-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 7694999 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-prop-2-enyl-3-[(E)-pyridin-4-ylmethylideneamino]thiourea |
| SMILES | C=CCNC(=S)N/N=C/c1ccncc1 |
| InChI | InChI=1S/C10H12N4S/c1-2-5-12-10(15)14-13-8-9-3-6-11-7-4-9/h2-4,6-8H,1,5H2,(H2,12,14,15)/b13-8+ |
| InChIKey | MWDILMNZYCWAOS-MDWZMJQESA-N |
| XLogP | 1.07 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|