About N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine
N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 769518) has the molecular formula C14H12FN3S
and a molecular weight of 273.34 g/mol. Its IUPAC name is N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 769518 |
| Molecular Formula | C14H12FN3S |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2ncnc(Nc3cccc(F)c3)c2c1C |
| InChI | InChI=1S/C14H12FN3S/c1-8-9(2)19-14-12(8)13(16-7-17-14)18-11-5-3-4-10(15)6-11/h3-7H,1-2H3,(H,16,17,18) |
| InChIKey | ICFQTVIFPKTBKP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (CID 769518) is N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine is Cc1sc2ncnc(Nc3cccc(F)c3)c2c1C.
What is the InChIKey of N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is ICFQTVIFPKTBKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3S/c1-8-9(2)19-14-12(8)13(16-7-17-14)18-11-5-3-4-10(15)6-11/h3-7H,1-2H3,(H,16,17,18).
What are the key properties of N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine?
N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 273.34 g/mol, XLogP of 4.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorophenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 769518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).