C10H15N7O2S — CID 76951996
5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 76951996) has the molecular formula C10H15N7O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 76951996 |
| Molecular Formula | C10H15N7O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | CCn1c(Sc2c(C(N)=NO)c(C)nn2C)n[nH]c1=O |
| InChI | InChI=1S/C10H15N7O2S/c1-4-17-9(18)12-13-10(17)20-8-6(7(11)15-19)5(2)14-16(8)3/h19H,4H2,1-3H3,(H2,11,15)(H,12,18) |
| InChIKey | YRRMVJPKAPWHSU-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|