C8H11F3N4O2 — CID 76952018
N'-hydroxy-1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carboximidamide (PubChem CID 76952018) has the molecular formula C8H11F3N4O2 and a molecular weight of 252.20 g/mol. Its IUPAC name is N'-hydroxy-1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carboximidamide.
| Compound Name | N'-hydroxy-1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 76952018 |
| Molecular Formula | C8H11F3N4O2 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | N'-hydroxy-1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carboximidamide |
| SMILES | Cc1nn(C)c(OCC(F)(F)F)c1C(N)=NO |
| InChI | InChI=1S/C8H11F3N4O2/c1-4-5(6(12)14-16)7(15(2)13-4)17-3-8(9,10)11/h16H,3H2,1-2H3,(H2,12,14) |
| InChIKey | RXDMLYUOJCJBCT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|